| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:03 UTC |
|---|
| Update Date | 2025-03-25 00:46:34 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02155949 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H23NO8P+ |
|---|
| Molecular Mass | 316.1156 |
|---|
| SMILES | C[N+](C)(C)C1C(CO)OC(COP(=O)(O)O)C(O)C1O |
|---|
| InChI Key | OJPVHRIHTGFFGR-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | monoalkyl phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcohols1,3-aminoalcoholsaminesaminosaccharidesdialkyl ethershydrocarbon derivativesmonosaccharidesorganic cationsorganic oxidesorganic saltsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcoholstetraalkylammonium salts |
|---|
| Substituents | ethermonosaccharidedialkyl ethersaccharideorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundorganic cationoxaneorganic saltprimary alcoholorganoheterocyclic compoundalcoholamino saccharide1,3-aminoalcoholtetraalkylammonium salt1,2-aminoalcoholquaternary ammonium saltoxacycleorganic oxygen compoundmonoalkyl phosphatesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
