Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:40:07 UTC |
---|
Update Date | 2025-03-25 00:46:35 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02156073 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C12H16N2O2S |
---|
Molecular Mass | 252.0932 |
---|
SMILES | CSCCC(NC(=O)c1ccccc1)C(N)=O |
---|
InChI Key | NBLKELFQDXBKFY-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | methionine and derivatives |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | alpha amino acidsbenzoyl derivativescarbonyl compoundscarboxylic acids and derivativesdialkylthioethersfatty amideshippuric acids and derivativeshydrocarbon derivativesn-acyl-alpha amino acidsorganic oxidesorganonitrogen compoundsorganopnictogen compoundsprimary carboxylic acid amidessecondary carboxylic acid amidessulfenyl compounds |
---|
Substituents | primary carboxylic acid amidefatty acylmonocyclic benzene moietycarbonyl groupfatty amidebenzoylorganosulfur compoundbenzamideorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundn-acyl-alpha amino acid or derivativessulfenyl compoundn-acyl-alpha-amino aciddialkylthioetherhippuric acid or derivativesbenzoic acid or derivativescarboxamide grouparomatic homomonocyclic compoundsecondary carboxylic acid amideorganic oxygen compoundthioethermethionine or derivativeshydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
---|