| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:10 UTC |
|---|
| Update Date | 2025-03-25 00:46:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02156169 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H14N2O3 |
|---|
| Molecular Mass | 210.1004 |
|---|
| SMILES | CC(=O)C1=NC(CC(C)C)C(=O)NC1=O |
|---|
| InChI Key | MWRLGOLZJBYBMT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarboxylic acids and derivativesdicarboximideshydrocarbon derivativesketiminesketonesn-unsubstituted carboxylic acid imidesorganic oxidesorganopnictogen compoundspropargyl-type 1,3-dipolar organic compounds |
|---|
| Substituents | ketiminecarbonyl groupazacycleimineorganic 1,3-dipolar compoundcarboxylic acid imidepropargyl-type 1,3-dipolar organic compoundketonecarboxylic acid imide, n-unsubstitutedorganic oxideorganic oxygen compoundaliphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativedicarboximideorganic nitrogen compoundorganoheterocyclic compoundorganooxygen compound |
|---|
