| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:15 UTC |
|---|
| Update Date | 2025-03-25 00:46:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02156354 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H18NO2+ |
|---|
| Molecular Mass | 220.1332 |
|---|
| SMILES | C[N+]1(C)CCC(=O)CC1c1ccc(O)cc1 |
|---|
| InChI Key | OGUOTUYFCXMYDF-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | piperidines |
|---|
| Subclass | phenylpiperidines |
|---|
| Direct Parent | phenylpiperidines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaralkylaminesazacyclic compoundsbenzene and substituted derivativescyclic ketoneshydrocarbon derivativesorganic cationsorganic oxidesorganic saltsorganopnictogen compoundspiperidinonestetraalkylammonium salts |
|---|
| Substituents | monocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compound1-hydroxy-2-unsubstituted benzenoidcyclic ketonearalkylamineketoneorganic oxideorganonitrogen compoundorganopnictogen compoundpiperidinoneorganic cationorganic salttetraalkylammonium saltazacyclequaternary ammonium saltorganic oxygen compoundphenylpiperidinephenolhydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|