| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:16 UTC |
|---|
| Update Date | 2025-03-25 00:46:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02156391 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H15NO2PS2+ |
|---|
| Molecular Mass | 216.0276 |
|---|
| SMILES | C[N+](C)(C)CCO[PH](O)(=S)=S |
|---|
| InChI Key | CENPGKBMLOQRHB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic thiophosphoric acids and derivatives |
|---|
| Subclass | thiophosphoric acid esters |
|---|
| Direct Parent | thiophosphoric acid esters |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | amineshydrocarbon derivativesorganic cationsorganic saltsorganooxygen compoundsorganopnictogen compoundstetraalkylammonium salts |
|---|
| Substituents | aliphatic acyclic compoundtetraalkylammonium saltthiophosphoric acid esterquaternary ammonium saltorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic cationorganic saltamineorganooxygen compound |
|---|
