| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:16 UTC |
|---|
| Update Date | 2025-03-25 00:46:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02156399 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H20NO+ |
|---|
| Molecular Mass | 230.1539 |
|---|
| SMILES | C[N+](C)(C)CCc1cccc2ccc(O)cc12 |
|---|
| InChI Key | ZUDMPOUHRZKXDB-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthols and derivatives |
|---|
| Direct Parent | naphthols and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsamineshydrocarbon derivativesorganic cationsorganic saltsorganooxygen compoundsorganopnictogen compoundsphenethylaminestetraalkylammonium salts |
|---|
| Substituents | tetraalkylammonium saltquaternary ammonium salt1-hydroxy-2-unsubstituted benzenoidaromatic homopolycyclic compoundphenethylamineorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic cationorganic salt2-naphtholamineorganooxygen compound |
|---|
