| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:16 UTC |
|---|
| Update Date | 2025-03-25 00:46:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02156424 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H17NO6 |
|---|
| Molecular Mass | 223.1056 |
|---|
| SMILES | C[N+](C)([O-])CC1OC(O)C(O)C(O)C1O |
|---|
| InChI Key | IKEMCYXPGKMXMI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | hemiacetalshydrocarbon derivativesorganic oxidesorganic oxoanionic compoundsorganopnictogen compoundsoxacyclic compoundsoxanessecondary alcoholstrialkyl amine oxidestrisubstituted amine oxides and derivatives |
|---|
| Substituents | alcoholn-oxidetrialkyl amine oxidemonosaccharideoxacycleorganic oxidetrisubstituted n-oxideaminoxidealiphatic heteromonocyclic compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhemiacetalhydrocarbon derivativeorganic nitrogen compoundoxaneorganoheterocyclic compoundorganic hyponitrite |
|---|
