| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:17 UTC |
|---|
| Update Date | 2025-03-25 00:46:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02156428 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H47NO11+ |
|---|
| Molecular Mass | 501.3144 |
|---|
| SMILES | C[N+](CCOCCOCCOCCOCCOCCOCCO)COCCOCCOCCO |
|---|
| InChI Key | OHZIPMHIZRBHQQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | amines |
|---|
| Direct Parent | hemiaminals |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alcohols and polyolsdialkyl ethershydrocarbon derivativesorganic cationsorganonitrogen compoundsorganopnictogen compounds |
|---|
| Substituents | alcoholaliphatic acyclic compoundetherdialkyl etherhemiaminalorganic oxygen compoundorganopnictogen compoundhydrocarbon derivativeorganic cationorganooxygen compound |
|---|