| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:17 UTC |
|---|
| Update Date | 2025-03-25 00:46:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02156438 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H17N2O+ |
|---|
| Molecular Mass | 193.1335 |
|---|
| SMILES | C[N+](C)(C)Cc1cccc(C(N)=O)c1 |
|---|
| InChI Key | UYRGBUIJBRPNKS-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aralkylaminesbenzoyl derivativesbenzylaminescarboxylic acids and derivativeshydrocarbon derivativesorganic cationsorganic oxidesorganic saltsorganooxygen compoundsorganopnictogen compoundsphenylmethylaminesprimary carboxylic acid amidestetraalkylammonium salts |
|---|
| Substituents | primary carboxylic acid amidebenzoylcarboxylic acid derivativearalkylaminebenzamideorganic oxideorganonitrogen compoundorganopnictogen compoundorganic cationorganic salttetraalkylammonium saltquaternary ammonium saltcarboxamide grouparomatic homomonocyclic compoundphenylmethylamineorganic oxygen compoundbenzylaminehydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
