| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:18 UTC |
|---|
| Update Date | 2025-03-25 00:46:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02156479 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H18O |
|---|
| Molecular Mass | 238.1358 |
|---|
| SMILES | Cc1c(C)c2c(c(C)c1O)CCc1ccccc1-2 |
|---|
| InChI Key | XNGVXJVUQRVTBL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrenes and derivatives |
|---|
| Direct Parent | phenanthrenes and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesnaphthalenesorganooxygen compounds |
|---|
| Substituents | phenanthrenenaphthaleneorganic oxygen compoundaromatic homopolycyclic compoundhydrocarbon derivativeorganooxygen compound |
|---|
