| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:18 UTC |
|---|
| Update Date | 2025-03-25 00:46:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02156484 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H18O2 |
|---|
| Molecular Mass | 242.1307 |
|---|
| SMILES | Cc1c(C)c2cc3c(cc2oc1=O)C(C)CCC3 |
|---|
| InChI Key | AJVTYVXCJPUEFZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | naphthopyrans |
|---|
| Subclass | naphthopyrans |
|---|
| Direct Parent | naphthopyrans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyranscoumarins and derivativesheteroaromatic compoundshydrocarbon derivativeslactonesnaphthalenesorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivativestetralins |
|---|
| Substituents | tetralinbenzopyran1-benzopyranheteroaromatic compoundcoumarinlactoneoxacyclenaphthopyranorganic oxidenaphthaleneorganic oxygen compoundaromatic heteropolycyclic compoundpyranpyranonehydrocarbon derivativebenzenoidorganooxygen compound |
|---|
