| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:20 UTC |
|---|
| Update Date | 2025-03-25 00:46:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02156563 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H19NO4 |
|---|
| Molecular Mass | 313.1314 |
|---|
| SMILES | O=C1CC(c2ccc(O)cc2)C(O)C(Cc2ccc(O)cc2)N1 |
|---|
| InChI Key | FLWUHZIVQCPSRD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | piperidines |
|---|
| Subclass | benzylpiperidines |
|---|
| Direct Parent | 2-benzylpiperidines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboxylic acids and derivativesdelta lactamshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenylpiperidinespiperidinonessecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | monocyclic benzene moietycarbonyl group2-benzylpiperidinelactamaromatic heteromonocyclic compound1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundpiperidinonealcoholazacyclecarboxamide groupdelta-lactamsecondary carboxylic acid amideorganic oxygen compoundphenylpiperidinesecondary alcoholphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|