| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:21 UTC |
|---|
| Update Date | 2025-03-25 00:46:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02156580 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H11N3O3 |
|---|
| Molecular Mass | 233.08 |
|---|
| SMILES | O=C1CCC(C(=O)Nc2ccc(O)cc2)=NN1 |
|---|
| InChI Key | SOUNGAIFJMFCBB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | anilides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-arylamidesorganic oxidesorganopnictogen compoundspyridazinonessecondary carboxylic acid amides |
|---|
| Substituents | carbonyl grouparomatic heteromonocyclic compoundazacycle1-hydroxy-2-unsubstituted benzenoidn-arylamidecarboxamide groupcarboxylic acid derivativeanilidesecondary carboxylic acid amideorganic oxideorganic oxygen compoundpyridazineorganonitrogen compoundorganopnictogen compoundphenolhydrocarbon derivativepyridazinoneorganic nitrogen compoundorganoheterocyclic compoundorganooxygen compound |
|---|
