Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:40:21 UTC |
---|
Update Date | 2025-03-25 00:46:40 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02156593 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C14H17N2O8P |
---|
Molecular Mass | 372.0723 |
---|
SMILES | O=C1CCC(C(=O)NC(Cc2ccc(OP(=O)(O)O)cc2)C(=O)O)N1 |
---|
InChI Key | LZYGNLHKUXZGMU-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | dipeptides |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | alpha amino acid amidesalpha amino acidsamphetamines and derivativesazacyclic compoundscarbonyl compoundscarboxylic acidshydrocarbon derivativeslactamsmonocarboxylic acids and derivativesn-acyl-alpha amino acidsorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenoxy compoundsphenyl phosphatesphenylalanine and derivativesphenylpropanoic acidsproline and derivativespyrrolidine-2-onespyrrolidinecarboxamidessecondary carboxylic acid amides |
---|
Substituents | 2-pyrrolidonemonocyclic benzene moietycarbonyl grouplactamcarboxylic acidaromatic heteromonocyclic compound3-phenylpropanoic-acidalpha-amino acid or derivativesorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundpyrrolidinepyrrolidoneorganoheterocyclic compoundamphetamine or derivativesn-acyl-alpha amino acid or derivativesproline or derivativesalpha-amino acid amideazacyclen-acyl-alpha-amino acidphenyl phosphatecarboxamide groupalpha-dipeptidesecondary carboxylic acid amidemonocarboxylic acid or derivativespyrrolidine carboxylic acid or derivativesphenylalanine or derivativesorganic oxygen compoundphosphoric acid esterhydrocarbon derivativearyl phosphomonoesterbenzenoidorganic nitrogen compoundpyrrolidine-2-carboxamidephenoxy compoundaryl phosphateorganic phosphoric acid derivativeorganooxygen compound |
---|