Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:40:21 UTC |
---|
Update Date | 2025-03-25 00:46:40 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02156600 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C15H14N2O2 |
---|
Molecular Mass | 254.1055 |
---|
SMILES | O=C1CC(c2ccccc2O)Nc2ccccc2N1 |
---|
InChI Key | RULWLMMARPDSQB-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organoheterocyclic compounds |
---|
Class | benzodiazepines |
---|
Subclass | benzodiazepines |
---|
Direct Parent | benzodiazepines |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | 1,4-diazepines1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsazacyclic compoundsbenzene and substituted derivativesbeta amino acids and derivativescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativeslactamsorganic oxidesorganopnictogen compoundssecondary alkylarylaminessecondary carboxylic acid amides |
---|
Substituents | monocyclic benzene moietycarbonyl grouplactamamino acid or derivatives1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativeorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundazacyclebenzodiazepine1-hydroxy-4-unsubstituted benzenoidsecondary aminecarboxamide groupbeta amino acid or derivativessecondary aliphatic/aromatic aminesecondary carboxylic acid amidepara-diazepineorganic oxygen compoundphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
---|