| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:21 UTC |
|---|
| Update Date | 2025-03-25 00:46:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02156608 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H11F3N2O2 |
|---|
| Molecular Mass | 260.0773 |
|---|
| SMILES | O=C1CC(O)(C(F)(F)F)CC(c2cccnc2)N1 |
|---|
| InChI Key | CUFJLYSQSGAWLU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | alkaloids and derivatives |
|---|
| Class | Not Available |
|---|
| Subclass | alkaloids and derivatives |
|---|
| Direct Parent | alkaloids and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdelta lactamsfluorohydrinsheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesorganic oxidesorganofluoridesorganonitrogen compoundsorganopnictogen compoundspiperidinonessecondary carboxylic acid amidestertiary alcohols |
|---|
| Substituents | carbonyl grouplactamaromatic heteromonocyclic compoundfluorohydrincarboxylic acid derivativeorganohalogen compoundorganic oxideorganonitrogen compoundorganopnictogen compoundalkyl halidepiperidinonepiperidineorganoheterocyclic compoundalcoholazacyclehalohydrinalkyl fluorideorganofluorideheteroaromatic compoundhydroxypyridinecarboxamide groupdelta-lactamsecondary carboxylic acid amidetertiary alcoholalkaloid or derivativespyridineorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
