| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:24 UTC |
|---|
| Update Date | 2025-03-25 00:46:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02156717 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H19NO7 |
|---|
| Molecular Mass | 277.1162 |
|---|
| SMILES | O=C1CCC(O)CN1C1OC(CO)C(O)C(O)C1O |
|---|
| InChI Key | RJCVHKIGZHJZLE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acyl glycosides |
|---|
| Direct Parent | fatty acyl glycosides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdelta lactamshydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanespiperidinonesprimary alcoholssecondary alcoholstertiary carboxylic acid amides |
|---|
| Substituents | carbonyl grouplactammonosaccharidecarboxylic acid derivativesaccharideorganic oxidetertiary carboxylic acid amidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundpiperidinoneoxaneprimary alcoholpiperidineorganoheterocyclic compoundalcoholazacyclefatty n-acyl glycosidecarboxamide groupdelta-lactamoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
