| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:27 UTC |
|---|
| Update Date | 2025-03-25 00:46:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02156813 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H10O4 |
|---|
| Molecular Mass | 242.0579 |
|---|
| SMILES | O=C(OC(=O)c1ccc(O)cc1)c1ccccc1 |
|---|
| InChI Key | VTMPYKRCBKYPJR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzyloxycarbonyls |
|---|
| Direct Parent | benzyloxycarbonyls |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsbenzoic acids and derivativesbenzoyl derivativescarboxylic acid anhydridesdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganooxygen compounds |
|---|
| Substituents | benzyloxycarbonylbenzoyl1-hydroxy-2-unsubstituted benzenoidbenzoic acid or derivativescarboxylic acid derivativearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundcarboxylic acid anhydridedicarboxylic acid or derivativesphenolhydrocarbon derivativeorganooxygen compound |
|---|
