| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:28 UTC |
|---|
| Update Date | 2025-03-25 00:46:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02156841 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H13ClO7 |
|---|
| Molecular Mass | 304.035 |
|---|
| SMILES | O=C(OC1OC(Cl)C(O)C(O)C1O)c1ccccc1O |
|---|
| InChI Key | OLMHUCZQBTTXRI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | o-hydroxybenzoic acid esters |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetalsalkyl chloridesbenzoyl derivativescarboxylic acid esterschlorohydrinshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganochloridesoxacyclic compoundsoxanessalicylic acid and derivativessecondary alcoholsvinylogous acids |
|---|
| Substituents | chlorohydrinaromatic heteromonocyclic compoundalkyl chlorideorganochloridebenzoyl1-hydroxy-2-unsubstituted benzenoidmonosaccharidecarboxylic acid derivativeorganohalogen compoundsaccharideorganic oxideacetalalkyl halideoxaneorganoheterocyclic compoundalcoholhalohydrin1-hydroxy-4-unsubstituted benzenoidoxacyclevinylogous acidmonocarboxylic acid or derivativesorganic oxygen compoundsalicylic acid or derivativeso-hydroxybenzoic acid estercarboxylic acid estersecondary alcoholphenolhydrocarbon derivativeorganooxygen compound |
|---|
