Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:40:28 UTC |
---|
Update Date | 2025-03-25 00:46:42 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02156845 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C13H15ClO7 |
---|
Molecular Mass | 318.0506 |
---|
SMILES | O=C(OC1OC(CCl)C(O)C(O)C1O)c1ccccc1O |
---|
InChI Key | LYXSYHKWKMAWBJ-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | benzenoids |
---|
Class | benzene and substituted derivatives |
---|
Subclass | benzoic acids and derivatives |
---|
Direct Parent | o-hydroxybenzoic acid esters |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetalsalkyl chloridesbenzoyl derivativescarboxylic acid estershydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganochloridesoxacyclic compoundsoxanessalicylic acid and derivativessecondary alcoholsvinylogous acids |
---|
Substituents | aromatic heteromonocyclic compoundalkyl chlorideorganochloridebenzoyl1-hydroxy-2-unsubstituted benzenoidmonosaccharidecarboxylic acid derivativeorganohalogen compoundsaccharideorganic oxideacetalalkyl halideoxaneorganoheterocyclic compoundalcohol1-hydroxy-4-unsubstituted benzenoidoxacyclevinylogous acidmonocarboxylic acid or derivativesorganic oxygen compoundsalicylic acid or derivativeso-hydroxybenzoic acid estercarboxylic acid estersecondary alcoholphenolhydrocarbon derivativeorganooxygen compound |
---|