| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:28 UTC |
|---|
| Update Date | 2025-03-25 00:46:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02156852 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H11NO2S |
|---|
| Molecular Mass | 269.051 |
|---|
| SMILES | O=C(O)c1ccccc1Sc1c[nH]c2ccccc12 |
|---|
| InChI Key | VYOVKKAMNYGUSA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organosulfur compounds |
|---|
| Class | thioethers |
|---|
| Subclass | aryl thioethers |
|---|
| Direct Parent | diarylthioethers |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compoundsazacyclic compoundsbenzoic acidsbenzoyl derivativesheteroaromatic compoundshydrocarbon derivativesindolesmonocarboxylic acids and derivativeso-sulfanylbenzoic acidsorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspyrrolessulfenyl compoundsthiophenol ethersthiophenolsvinylogous thioesters |
|---|
| Substituents | monocyclic benzene moietycarboxylic acidindolebenzoylcarboxylic acid derivativeorganic oxidethiophenolaromatic heteropolycyclic compoundo-sulfanylbenzoic acidthiophenol etherorganonitrogen compoundorganopnictogen compound1-carboxy-2-haloaromatic compoundbenzoic acidorganoheterocyclic compounddiarylthioethervinylogous thioestersulfenyl compoundazacycleheteroaromatic compoundindole or derivativesbenzoic acid or derivativeso-sulfanylbenzoic acid or derivativesmonocarboxylic acid or derivativesorganic oxygen compoundpyrrolehydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|