| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:31 UTC |
|---|
| Update Date | 2025-03-25 00:46:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02156958 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C3H2F4O4S2 |
|---|
| Molecular Mass | 241.9331 |
|---|
| SMILES | O=C(S)C(F)(F)C(F)(F)S(=O)(=O)O |
|---|
| InChI Key | SMLIODGVRBWZBD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfonic acids and derivatives |
|---|
| Subclass | organosulfonic acids and derivatives |
|---|
| Direct Parent | organosulfonic acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesalkylthiolscarbodithioic acidscarbonyl compoundscarbothioic s-acidscarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganofluoridessulfonylsthiocarboxylic acids and derivativesthiolactones |
|---|
| Substituents | aliphatic acyclic compoundthiocarboxylic acid or derivativescarbonyl groupalkyl fluorideorganofluorideorganosulfonic acidcarbodithioic acidorganosulfur compoundcarboxylic acid derivativeorganohalogen compoundcarbothioic s-acidorganic oxidesulfonylorganic oxygen compoundalkyl halidehydrocarbon derivativethiolactonealkylthiolorganooxygen compound |
|---|
