| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:32 UTC |
|---|
| Update Date | 2025-03-25 00:46:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02156973 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H11NO6S |
|---|
| Molecular Mass | 309.0307 |
|---|
| SMILES | O=C(OS(=O)(=O)O)c1ccccc1Nc1ccc(O)cc1 |
|---|
| InChI Key | DYSYNHPVUGJARZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzoic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsamino acids and derivativesbenzoyl derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundssecondary aminessulfuric acid monoestersvinylogous amides |
|---|
| Substituents | vinylogous amidesulfuric acid monoesterorganic sulfuric acid or derivativesamino acid or derivativesbenzoyl1-hydroxy-2-unsubstituted benzenoidbenzoic acid or derivativessecondary aminecarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundphenolhydrocarbon derivativeorganic nitrogen compoundsulfuric acid esterorganooxygen compoundamine |
|---|
