| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:32 UTC |
|---|
| Update Date | 2025-03-25 00:46:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02156977 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H12O11P2 |
|---|
| Molecular Mass | 309.9855 |
|---|
| SMILES | O=C(OP(=O)(O)O)C(O)C(CO)COP(=O)(O)O |
|---|
| InChI Key | AKNHDSVKUXDBSM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | acyl monophosphates |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholaliphatic acyclic compoundcarbonyl groupacyl monophosphatemonosaccharidecarboxylic acid derivativesaccharideorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundmonoalkyl phosphatesecondary alcoholhydrocarbon derivativeprimary alcoholalkyl phosphateorganooxygen compound |
|---|
