| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:32 UTC |
|---|
| Update Date | 2025-03-25 00:46:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02156988 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H10O5 |
|---|
| Molecular Mass | 294.0528 |
|---|
| SMILES | O=C1C(O)=C(c2ccc(O)cc2)c2oc3cc(O)ccc3c21 |
|---|
| InChI Key | HLLRDODMXXUIHQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | benzofurans |
|---|
| Subclass | benzofurans |
|---|
| Direct Parent | benzofurans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaryl ketonesbenzene and substituted derivativesfuroic acid and derivativesheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganooxygen compoundsoxacyclic compounds |
|---|
| Substituents | furanmonocyclic benzene moietyfuroic acid or derivativesbenzofuranheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidketoneoxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundphenolhydrocarbon derivativebenzenoidorganooxygen compoundaryl ketone |
|---|
