| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:32 UTC |
|---|
| Update Date | 2025-03-25 00:46:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02156990 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H12O3 |
|---|
| Molecular Mass | 204.0786 |
|---|
| SMILES | C=CC(=O)OC(C(C)=O)c1ccccc1 |
|---|
| InChI Key | CSINQXXQHGTNMG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzyloxycarbonyls |
|---|
| Direct Parent | benzyloxycarbonyls |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha-acyloxy ketonesenoate estershydrocarbon derivativesketonesmonocarboxylic acids and derivativesorganic oxidesphenylpropanes |
|---|
| Substituents | benzyloxycarbonylenoate estercarbonyl groupalpha-acyloxy ketonecarboxylic acid derivativeketonephenylpropanearomatic homomonocyclic compoundalpha,beta-unsaturated carboxylic esterorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterhydrocarbon derivativeorganooxygen compound |
|---|