| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:33 UTC |
|---|
| Update Date | 2025-03-25 00:46:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02157003 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H8O4 |
|---|
| Molecular Mass | 228.0423 |
|---|
| SMILES | O=C1Oc2ccccc2Oc2ccc(O)cc21 |
|---|
| InChI Key | SRCUHDQUZKQHOX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | depsides and depsidones |
|---|
| Subclass | depsides and depsidones |
|---|
| Direct Parent | depsides and depsidones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,4-dioxepines1-hydroxy-2-unsubstituted benzenoidsbenzenoidscarboxylic acid estersdiarylethershydrocarbon derivativeslactonesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compounds |
|---|
| Substituents | diaryl etheretherdepsidone1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativelactoneoxacycleorganic oxidemonocarboxylic acid or derivativesorganic oxygen compounddioxepinearomatic heteropolycyclic compoundcarboxylic acid esterhydrocarbon derivativebenzenoidorganoheterocyclic compound1,4-dioxepineorganooxygen compound |
|---|