| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:33 UTC |
|---|
| Update Date | 2025-03-25 00:46:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02157024 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C3H2O9S2 |
|---|
| Molecular Mass | 245.914 |
|---|
| SMILES | O=C1OS(=O)(=O)C(OS(=O)(=O)O)=C1O |
|---|
| InChI Key | ITXKNPJKXFLYKS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | sulfuric acid esters |
|---|
| Direct Parent | sulfuric acid monoesters |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganosulfonic acids and derivativesoxacyclic compoundsoxathioles |
|---|
| Substituents | organosulfonic acid or derivativessulfuric acid monoestercarbonyl groupcarboxylic acid derivativeoxacycleorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganic sulfonic acid or derivatives1,2-oxathiolealiphatic heteromonocyclic compoundsulfate-esterhydrocarbon derivativeorganoheterocyclic compoundorganooxygen compound |
|---|
