| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:34 UTC |
|---|
| Update Date | 2025-03-25 00:46:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02157065 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H16O6 |
|---|
| Molecular Mass | 340.0947 |
|---|
| SMILES | O=C1OC(c2ccc(O)cc2)C2C1COC2c1ccc2c(c1)OCO2 |
|---|
| InChI Key | KATAQIIRDXFORX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lignans, neolignans and related compounds |
|---|
| Class | lignan lactones |
|---|
| Subclass | lignan lactones |
|---|
| Direct Parent | lignan lactones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsacetalsbenzene and substituted derivativesbenzodioxolescarbonyl compoundscarboxylic acid estersdialkyl ethersfuran lignansfurofuran lignansfurofuransgamma butyrolactoneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundstetrahydrofurans |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupetherfurofuran lignan skeleton1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativedialkyl etherlignan lactonelactoneorganic oxideacetalaromatic heteropolycyclic compoundfurofuranorganoheterocyclic compoundbenzodioxoletetrahydrofurangamma butyrolactoneoxacyclefuran lignan skeletonmonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterfuranoid lignanphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|