| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:35 UTC |
|---|
| Update Date | 2025-03-25 00:46:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02157095 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H22O8 |
|---|
| Molecular Mass | 342.1315 |
|---|
| SMILES | O=CC(O)C(Cc1ccccc1)OC1OC(CO)C(O)C(O)C1O |
|---|
| InChI Key | ZCAVPPDCTIZNCG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsalpha-hydroxyaldehydesbenzene and substituted derivativeshydrocarbon derivativesorganic oxidesoxacyclic compoundsoxanesprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholmonocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compoundmonosaccharidealdehydeoxacycleorganic oxidealpha-hydroxyaldehydeacetalsecondary alcoholhydrocarbon derivativebenzenoidoxaneprimary alcoholorganoheterocyclic compound |
|---|