| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:36 UTC |
|---|
| Update Date | 2025-03-25 00:46:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02157113 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H32O18 |
|---|
| Molecular Mass | 560.1589 |
|---|
| SMILES | O=CC(O)C(O)C(OC1OC(CO)C(O)C(COC2(C(=O)O)CC(O)C(O)C(C(=O)O)O2)C1O)C(O)CO |
|---|
| InChI Key | DXRYRYAJYLZZCH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | saccharolipids |
|---|
| Subclass | saccharolipids |
|---|
| Direct Parent | saccharolipids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha-hydroxyaldehydesbeta hydroxy acids and derivativesbeta-hydroxy aldehydescarboxylic acidsdicarboxylic acids and derivativesfatty alcoholshydrocarbon derivativesketalsmonosaccharidesorganic oxidesoxacyclic compoundsoxanesprimary alcoholspyran carboxylic acidssecondary alcohols |
|---|
| Substituents | fatty acylbeta-hydroxy aldehydecarbonyl groupcarboxylic acidmonosaccharidecarboxylic acid derivativepyran carboxylic acidbeta-hydroxy acidsaccharideorganic oxidealpha-hydroxyaldehydeacetalfatty alcoholketalaliphatic heteromonocyclic compoundoxaneprimary alcoholorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativesaldehydehydroxy acidoxacycleorganic oxygen compoundpyransecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativesaccharolipidorganooxygen compound |
|---|