| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:38 UTC |
|---|
| Update Date | 2025-03-25 00:46:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02157216 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H14N2O3 |
|---|
| Molecular Mass | 306.1004 |
|---|
| SMILES | O=C1NC(=O)N(C(=O)Cc2ccccc2)C1=Cc1ccccc1 |
|---|
| InChI Key | HWYGYJHOBHWGDO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | azolidines |
|---|
| Subclass | imidazolidines |
|---|
| Direct Parent | hydantoins |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdicarboximideshydrocarbon derivativesimidazolidinonesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenylacetamides |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarbonic acid derivativearomatic heteromonocyclic compoundazacyclealpha-amino acid or derivativescarboxylic acid derivativeorganic oxideorganic oxygen compoundhydantoinorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativebenzenoiddicarboximideorganic nitrogen compoundphenylacetamideorganooxygen compound |
|---|
