| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:39 UTC |
|---|
| Update Date | 2025-03-25 00:46:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02157232 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H18N2O |
|---|
| Molecular Mass | 242.1419 |
|---|
| SMILES | O=C1CCCCN1CCc1c[nH]c2ccccc12 |
|---|
| InChI Key | MHDIVKHYLSDJNX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indoles |
|---|
| Direct Parent | indoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzenoidscarbonyl compoundscarboxylic acids and derivativesdelta lactamsheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspiperidinonespyrrolestertiary carboxylic acid amides |
|---|
| Substituents | carbonyl grouplactamazacycleindoleheteroaromatic compoundcarboxamide groupcarboxylic acid derivativedelta-lactamorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundtertiary carboxylic acid amidepyrroleorganonitrogen compoundorganopnictogen compoundpiperidinonehydrocarbon derivativebenzenoidorganic nitrogen compoundpiperidineorganooxygen compound |
|---|
