| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:41 UTC |
|---|
| Update Date | 2025-03-25 00:46:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02157308 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H9O9P |
|---|
| Molecular Mass | 255.9984 |
|---|
| SMILES | O=C1OC(C(O)C(O)COP(=O)(O)O)C1=O |
|---|
| InChI Key | PMZYKGCIEUGGAH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | monoalkyl phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsbeta propiolactonescarboxylic acid esterscyclic ketoneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsoxetanessecondary alcohols |
|---|
| Substituents | alcoholcarbonyl groupcyclic ketonecarboxylic acid derivativebeta_propiolactoneketonelactoneoxacycleorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundmonoalkyl phosphatecarboxylic acid esteroxetanealiphatic heteromonocyclic compoundsecondary alcoholhydrocarbon derivativeorganoheterocyclic compoundorganooxygen compound1,2-diol |
|---|
