| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:41 UTC |
|---|
| Update Date | 2025-03-25 00:46:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02157312 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H7NO3 |
|---|
| Molecular Mass | 201.0426 |
|---|
| SMILES | O=C1Nc2ccc(O)c3c(O)ccc1c23 |
|---|
| InChI Key | XUPKITOMCNAUFQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthols and derivatives |
|---|
| Direct Parent | naphthols and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsazacyclic compoundscarboxylic acids and derivativeshydrocarbon derivativesindolesisoindolesisoindoloneslactamsorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundssecondary carboxylic acid amides |
|---|
| Substituents | lactamazacycleisoindoleindole1-hydroxy-2-unsubstituted benzenoidindole or derivativescarboxamide groupcarboxylic acid derivativesecondary carboxylic acid amideisoindoloneorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundisoindole or derivativesorganonitrogen compoundorganopnictogen compoundhydrocarbon derivative1-naphtholorganic nitrogen compoundorganoheterocyclic compoundorganooxygen compound |
|---|