Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:40:41 UTC |
---|
Update Date | 2025-03-25 00:46:47 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02157320 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C15H17NO10 |
---|
Molecular Mass | 371.0852 |
---|
SMILES | O=C1Nc2cc(O)ccc2C(O)C1OC1OC(C(=O)O)C(O)C(O)C1O |
---|
InChI Key | VNBVITBVTJXVMJ-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic oxygen compounds |
---|
Class | organooxygen compounds |
---|
Subclass | carbohydrates and carbohydrate conjugates |
---|
Direct Parent | o-glucuronides |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsacetalsazacyclic compoundsbenzenoidsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsglucuronic acid derivativeshydrocarbon derivativeshydroquinolineshydroquinoloneslactamsmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanespyran carboxylic acidssecondary alcoholssecondary carboxylic acid amides |
---|
Substituents | carbonyl grouplactamcarboxylic acido-glucuronide1-hydroxy-2-unsubstituted benzenoidmonosaccharidecarboxylic acid derivativepyran carboxylic acid1-o-glucuronidebeta-hydroxy acidorganic oxideacetalaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundoxanetetrahydroquinolineorganoheterocyclic compoundalcoholquinolonetetrahydroquinolonepyran carboxylic acid or derivativesazacyclehydroxy acidcarboxamide groupoxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativespyransecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compound |
---|