| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:41 UTC |
|---|
| Update Date | 2025-03-25 00:46:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02157328 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H17O13P |
|---|
| Molecular Mass | 388.0407 |
|---|
| SMILES | O=C1OC(COP(=O)(O)OCC2OC(=O)C(O)C(O)C2O)C(O)C1O |
|---|
| InChI Key | NCMDWZJWTQGKIJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | hexose phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acid estersdelta valerolactonesdialkyl phosphatesdicarboxylic acids and derivativesgamma butyrolactonesgluconolactoneshydrocarbon derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanessecondary alcoholstetrahydrofurans |
|---|
| Substituents | carbonyl groupdelta valerolactonecarboxylic acid derivativelactoneorganic oxidegluconolactonealiphatic heteromonocyclic compoundoxanedelta_valerolactoneorganoheterocyclic compoundalcoholtetrahydrofurangamma butyrolactoneoxacycledialkyl phosphatephosphoric acid estercarboxylic acid estersecondary alcoholhexose phosphatedicarboxylic acid or derivativeshydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphate |
|---|