| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:42 UTC |
|---|
| Update Date | 2025-03-25 00:46:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02157336 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H17NO5 |
|---|
| Molecular Mass | 291.1107 |
|---|
| SMILES | O=C1OC(Cc2ccc(O)c(O)c2)C(=O)N2CCCCC12 |
|---|
| InChI Key | VIACHYPBNXAFAX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | peptidomimetics |
|---|
| Subclass | hybrid peptides |
|---|
| Direct Parent | hybrid peptides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalpha amino acid estersalpha amino acidsazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboxylic acid estershydrocarbon derivativeslactamslactonesmonocarboxylic acids and derivativesmorpholinesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundspiperidinestertiary carboxylic acid amides |
|---|
| Substituents | monocyclic benzene moietycarbonyl grouplactam1-hydroxy-2-unsubstituted benzenoidalpha-amino acid or derivativescarboxylic acid derivativelactoneorganic oxidearomatic heteropolycyclic compoundtertiary carboxylic acid amideorganonitrogen compoundalpha-amino acidorganopnictogen compoundpiperidineorganoheterocyclic compoundcyclic hybrid peptidealpha-amino acid esterazacycle1-hydroxy-4-unsubstituted benzenoidcarboxamide groupoxazinaneoxacyclemorpholinemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
