| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:42 UTC |
|---|
| Update Date | 2025-03-25 00:46:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02157343 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C4H4O8S |
|---|
| Molecular Mass | 211.9627 |
|---|
| SMILES | O=C1OC(COS(=O)(=O)O)OC1=O |
|---|
| InChI Key | GUNZAZDJEOTMDS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | sulfuric acid esters |
|---|
| Direct Parent | sulfuric acid monoesters |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-dioxolanesacetalsalkyl sulfatescarbonyl compoundscarboxylic acid estersdicarboxylic acids and derivativeshydrocarbon derivativeslactonesorganic oxidesoxacyclic compounds |
|---|
| Substituents | meta-dioxolanesulfuric acid monoestercarbonyl groupcarboxylic acid derivativelactoneoxacycleorganic oxideorganic oxygen compoundacetalcarboxylic acid esteralkyl sulfatealiphatic heteromonocyclic compounddicarboxylic acid or derivativessulfate-esterhydrocarbon derivativeorganoheterocyclic compoundorganooxygen compound |
|---|
