| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:42 UTC |
|---|
| Update Date | 2025-03-25 00:46:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02157349 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H8O7 |
|---|
| Molecular Mass | 192.027 |
|---|
| SMILES | O=C1OC(C(O)O)C(O)C(O)=C1O |
|---|
| InChI Key | LWFQYSOQXNVDMB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrans |
|---|
| Subclass | pyranones and derivatives |
|---|
| Direct Parent | dihydropyranones |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarbonyl hydratesenoate estershydrocarbon derivativeslactonesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundssecondary alcoholsvinylogous acids |
|---|
| Substituents | enoate esteralcoholcarbonyl groupcarbonyl hydratedihydropyranonecarboxylic acid derivativelactoneoxacyclealpha,beta-unsaturated carboxylic estervinylogous acidorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esteraliphatic heteromonocyclic compoundsecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|
