| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:42 UTC |
|---|
| Update Date | 2025-03-25 00:46:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02157354 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H16N2O6S |
|---|
| Molecular Mass | 292.0729 |
|---|
| SMILES | O=C1NC2CCC(CCCC(=O)OS(=O)(=O)O)C2N1 |
|---|
| InChI Key | YXZIEXOEMZCMRN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | azolidines |
|---|
| Subclass | imidazolidines |
|---|
| Direct Parent | imidazolidinones |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoestercarbonyl groupcarbonic acid derivativeorganic sulfuric acid or derivativesazacyclecarboxylic acid derivativealiphatic heteropolycyclic compoundimidazolidinoneorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundsulfuric acid esterorganooxygen compound |
|---|