| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:42 UTC |
|---|
| Update Date | 2025-03-25 00:46:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02157361 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H23N3O2S |
|---|
| Molecular Mass | 297.1511 |
|---|
| SMILES | O=C1NC2CSC(CCCCC(=O)N3CCCC3)C2N1 |
|---|
| InChI Key | SIUJWJINYBBLTE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | biotin and derivatives |
|---|
| Subclass | biotin and derivatives |
|---|
| Direct Parent | biotin and derivatives |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdialkylthioethershydrocarbon derivativesimidazolidinonesn-acylpyrrolidinesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundstertiary carboxylic acid amidesthienoimidazolidinesthiolanesthiophenes |
|---|
| Substituents | thiolaneimidazolidinecarbonyl groupn-acylpyrrolidinethiophenecarboxylic acid derivativealiphatic heteropolycyclic compoundimidazolidinoneorganic oxidebiotin_derivativetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundpyrrolidinecarbonic acid derivativeazacycledialkylthioetherthienoimidazolidinecarboxamide grouporganic oxygen compoundthioetherhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
