| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:43 UTC |
|---|
| Update Date | 2025-03-25 00:46:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02157377 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H14N2O2 |
|---|
| Molecular Mass | 230.1055 |
|---|
| SMILES | O=C1NN2C(=O)C(Cc3ccccc3)CCC12 |
|---|
| InChI Key | WHBCXSPAQUACEF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | piperidines |
|---|
| Subclass | benzylpiperidines |
|---|
| Direct Parent | 3-benzylpiperidines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alpha amino acidsazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboxylic acid hydrazidescarboxylic acids and derivativesdelta lactamsdiazetidineshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspiperidinones |
|---|
| Substituents | 1,2-diazetidinemonocyclic benzene moietycarboxylic acid hydrazidecarbonyl groupazacyclealpha-amino acid or derivativescarboxylic acid derivativedelta-lactam3-benzylpiperidineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundpiperidinonehydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|