| Record Information | 
|---|
| HMDB Status | Not Available | 
|---|
| Creation Date | 2024-02-21 14:40:43 UTC | 
|---|
| Update Date | 2025-03-25 00:46:48 UTC | 
|---|
| HMDB ID | Not Available | 
|---|
| Metabolite Identification | 
|---|
| DeepMet ID | DMID02157399 | 
|---|
| Frequency | 0.5 | 
|---|
| Structure |  | 
|---|
| Chemical Formula | C12H15NO5 | 
|---|
| Molecular Mass | 253.095 | 
|---|
| SMILES | O=C(O)CCCNC(C(=O)O)c1ccc(O)cc1 | 
|---|
| InChI Key | OGHPNIGMXGMRQY-UHFFFAOYSA-N | 
|---|
| Chemical Taxonomy | 
|---|
| Kingdom | organic compounds | 
|---|
| Superclass | organic acids and derivatives | 
|---|
| Class | carboxylic acids and derivatives | 
|---|
| Subclass | amino acids, peptides, and analogues | 
|---|
| Direct Parent | gamma amino acids and derivatives | 
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds | 
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acidsamino acidsbenzene and substituted derivativescarbonyl compoundscarboxylic acidsdialkylaminesdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganopnictogen compounds | 
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidamino acidgamma amino acid or derivatives1-hydroxy-2-unsubstituted benzenoidalpha-amino acid or derivativesorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundsecondary aliphatic aminesecondary aminearomatic homomonocyclic compoundorganic oxygen compounddicarboxylic acid or derivativesphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compoundamine | 
|---|