| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:44 UTC |
|---|
| Update Date | 2025-03-25 00:46:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02157427 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H13O9P |
|---|
| Molecular Mass | 272.0297 |
|---|
| SMILES | O=C(O)CCCOP(=O)(O)OCC(O)C(=O)O |
|---|
| InChI Key | VRLUWWPYNCOCJH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | sugar acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdialkyl phosphatesdicarboxylic acids and derivativesfatty acids and conjugateshydrocarbon derivativesmonosaccharidesorganic oxidessecondary alcoholsshort-chain hydroxy acids and derivatives |
|---|
| Substituents | alcoholaliphatic acyclic compoundcarbonyl groupcarboxylic acidshort-chain hydroxy acidalpha-hydroxy acidmonosaccharidefatty acidhydroxy acidcarboxylic acid derivativedialkyl phosphateorganic oxidephosphoric acid esterglyceric_acidsecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphate |
|---|
