| Record Information | 
|---|
| HMDB Status | Not Available | 
|---|
| Creation Date | 2024-02-21 14:40:47 UTC | 
|---|
| Update Date | 2025-03-25 00:46:49 UTC | 
|---|
| HMDB ID | Not Available | 
|---|
| Metabolite Identification | 
|---|
| DeepMet ID | DMID02157505 | 
|---|
| Frequency | 0.5 | 
|---|
| Structure |  | 
|---|
| Chemical Formula | C15H17ClO8 | 
|---|
| Molecular Mass | 360.0612 | 
|---|
| SMILES | O=C(O)CCc1ccc(OC2OC(C(=O)O)C(O)C(O)C2Cl)cc1 | 
|---|
| InChI Key | QHAGSCBPIXVPLR-UHFFFAOYSA-N | 
|---|
| Chemical Taxonomy | 
|---|
| Kingdom | organic compounds | 
|---|
| Superclass | phenylpropanoids and polyketides | 
|---|
| Class | phenylpropanoic acids | 
|---|
| Subclass | phenylpropanoic acids | 
|---|
| Direct Parent | phenylpropanoic acids | 
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds | 
|---|
| Alternative Parents | 1,2-diolsacetalsalkyl chloridesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidschlorohydrinsdicarboxylic acids and derivativeshydrocarbon derivativesmonosaccharidesorganic oxidesorganochloridesoxacyclic compoundsoxanesphenol ethersphenoxy compoundspyran carboxylic acidssecondary alcohols | 
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupcarboxylic acidchlorohydrinaromatic heteromonocyclic compound3-phenylpropanoic-acidalkyl chlorideorganochloridemonosaccharidecarboxylic acid derivativeorganohalogen compoundpyran carboxylic acidbeta-hydroxy acidsaccharideorganic oxideacetalalkyl halideoxaneorganoheterocyclic compound1,2-diolalcoholpyran carboxylic acid or derivativeshalohydrinhydroxy acidoxacycleorganic oxygen compoundpyransecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compound | 
|---|