| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:49 UTC |
|---|
| Update Date | 2025-03-25 00:46:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02157584 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H16O8 |
|---|
| Molecular Mass | 348.0845 |
|---|
| SMILES | O=C(O)CCc1c(CC(=O)O)c2ccc1c(CC(=O)O)c2CC(=O)O |
|---|
| InChI Key | RUICKCGDKJSOQZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | tetracarboxylic acids and derivatives |
|---|
| Direct Parent | tetracarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | benzenoidscarbonyl compoundscarboxylic acidshydrocarbon derivativesorganic oxides |
|---|
| Substituents | carbonyl grouporganic oxidecarboxylic acidorganic oxygen compoundaromatic homopolycyclic compoundhydrocarbon derivativetetracarboxylic acid or derivativesbenzenoidorganooxygen compound |
|---|
