| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:49 UTC |
|---|
| Update Date | 2025-03-25 00:46:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02157603 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H17O10PS |
|---|
| Molecular Mass | 348.028 |
|---|
| SMILES | O=C(O)CCSCC1OC(OP(=O)(O)O)C(O)C(O)C1O |
|---|
| InChI Key | WKRSQOFOJYFXIG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | monoalkyl phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidsdialkylthioethershydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanessecondary alcoholssulfenyl compounds |
|---|
| Substituents | carbonyl groupcarboxylic acidmonosaccharideorganosulfur compoundcarboxylic acid derivativesaccharideorganic oxidealiphatic heteromonocyclic compoundoxaneorganoheterocyclic compoundalcoholsulfenyl compounddialkylthioetheroxacyclemonocarboxylic acid or derivativesorganic oxygen compoundthioethermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|
