| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:51 UTC |
|---|
| Update Date | 2025-03-25 00:46:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02157652 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H18O6 |
|---|
| Molecular Mass | 342.1103 |
|---|
| SMILES | O=C(O)CCC1c2cc(O)cc(O)c2C(=O)CC1c1ccc(O)cc1 |
|---|
| InChI Key | ARMNORGFZGVWFC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | phenylnaphthalenes |
|---|
| Direct Parent | phenylnaphthalenes |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsaryl alkyl ketonesbenzene and substituted derivativescarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidestetralinsvinylogous acids |
|---|
| Substituents | tetralinmonocyclic benzene moietycarbonyl groupcarboxylic acidaryl alkyl ketone1-hydroxy-2-unsubstituted benzenoidaromatic homopolycyclic compound1-hydroxy-4-unsubstituted benzenoidcarboxylic acid derivativeketonevinylogous acidorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundphenylnaphthalenephenolhydrocarbon derivativeorganooxygen compoundaryl ketone |
|---|
