| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:53 UTC |
|---|
| Update Date | 2025-03-25 00:46:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02157746 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H17NO3S |
|---|
| Molecular Mass | 255.0929 |
|---|
| SMILES | O=C(O)CCCCC1=C2CCC(=O)NC2CS1 |
|---|
| InChI Key | YNXKAGCBUVPLRN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acids and conjugates |
|---|
| Direct Parent | medium-chain fatty acids |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acidsdelta lactamsdihydrothiophenesfatty acylsheterocyclic fatty acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspiperidinonessecondary carboxylic acid amidesthioenol ethers |
|---|
| Substituents | carbonyl grouplactamcarboxylic acidheterocyclic fatty acidcarboxylic acid derivativealiphatic heteropolycyclic compoundorganic oxideorganonitrogen compoundorganopnictogen compoundpiperidinonemedium-chain fatty acidpiperidineorganoheterocyclic compoundazacycle2,3-dihydrothiophenecarboxamide groupdelta-lactamsecondary carboxylic acid amidemonocarboxylic acid or derivativesthioenoletherorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|